About benzyl 2-(2-phenylmethoxyphenyl)-1,3-oxazole-4-carboxylate
benzyl 2-(2-phenylmethoxyphenyl)-1,3-oxazole-4-carboxylate (PubChem CID 10200081) has the molecular formula C24H19NO4
and a molecular weight of 385.42 g/mol. Its IUPAC name is benzyl 2-(2-phenylmethoxyphenyl)-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-(2-phenylmethoxyphenyl)-1,3-oxazole-4-carboxylate |
| PubChem CID | 10200081 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | benzyl 2-(2-phenylmethoxyphenyl)-1,3-oxazole-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1coc(-c2ccccc2OCc2ccccc2)n1 |
| InChI | InChI=1S/C24H19NO4/c26-24(29-16-19-11-5-2-6-12-19)21-17-28-23(25-21)20-13-7-8-14-22(20)27-15-18-9-3-1-4-10-18/h1-14,17H,15-16H2 |
| InChIKey | LPZGIHNVYXUAOR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 2-(2-phenylmethoxyphenyl)-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(2-phenylmethoxyphenyl)-1,3-oxazole-4-carboxylate?
The IUPAC name of benzyl 2-(2-phenylmethoxyphenyl)-1,3-oxazole-4-carboxylate (CID 10200081) is benzyl 2-(2-phenylmethoxyphenyl)-1,3-oxazole-4-carboxylate.
What is the SMILES notation for benzyl 2-(2-phenylmethoxyphenyl)-1,3-oxazole-4-carboxylate?
The canonical SMILES for benzyl 2-(2-phenylmethoxyphenyl)-1,3-oxazole-4-carboxylate is O=C(OCc1ccccc1)c1coc(-c2ccccc2OCc2ccccc2)n1.
What is the InChIKey of benzyl 2-(2-phenylmethoxyphenyl)-1,3-oxazole-4-carboxylate?
The InChIKey is LPZGIHNVYXUAOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19NO4/c26-24(29-16-19-11-5-2-6-12-19)21-17-28-23(25-21)20-13-7-8-14-22(20)27-15-18-9-3-1-4-10-18/h1-14,17H,15-16H2.
What are the key properties of benzyl 2-(2-phenylmethoxyphenyl)-1,3-oxazole-4-carboxylate?
benzyl 2-(2-phenylmethoxyphenyl)-1,3-oxazole-4-carboxylate has a molecular weight of 385.42 g/mol, XLogP of 5.28, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(2-phenylmethoxyphenyl)-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 10200081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).