C12H20O3 — CID 102000893
(3S)-3-[[(Z)-prop-1-enoxy]methyl]-1,4-dioxaspiro[4.5]decane (PubChem CID 102000893) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (3S)-3-[[(Z)-prop-1-enoxy]methyl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | (3S)-3-[[(Z)-prop-1-enoxy]methyl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 102000893 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (3S)-3-[[(Z)-prop-1-enoxy]methyl]-1,4-dioxaspiro[4.5]decane |
| SMILES | C/C=C\OC[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C12H20O3/c1-2-8-13-9-11-10-14-12(15-11)6-4-3-5-7-12/h2,8,11H,3-7,9-10H2,1H3/b8-2-/t11-/m0/s1 |
| InChIKey | KDYNSCGKFJEFRG-BZCFKMEZSA-N |
| XLogP | 2.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|