C21H23NO4S — CID 10200104
5-[[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 10200104) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 5-[[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10200104 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 5-[[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(CC2SC(=O)NC2=O)cc(C)c1Oc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C21H23NO4S/c1-11(2)16-10-15(5-6-17(16)23)26-19-12(3)7-14(8-13(19)4)9-18-20(24)22-21(25)27-18/h5-8,10-11,18,23H,9H2,1-4H3,(H,22,24,25) |
| InChIKey | KTSOVZUQNVBSCB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|