C11H19N3 — CID 102001064
(1S,4R,6S,10R)-6,10-dimethyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene (PubChem CID 102001064) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (1S,4R,6S,10R)-6,10-dimethyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene.
| Compound Name | (1S,4R,6S,10R)-6,10-dimethyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
|---|---|
| PubChem CID | 102001064 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (1S,4R,6S,10R)-6,10-dimethyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
| SMILES | C[C@@H]1C[C@@H]2CC[C@@H]3C[C@H](C)N=C(N1)N32 |
| InChI | InChI=1S/C11H19N3/c1-7-5-9-3-4-10-6-8(2)13-11(12-7)14(9)10/h7-10H,3-6H2,1-2H3,(H,12,13)/t7-,8+,9+,10- |
| InChIKey | NMQGYKLVARCOKP-FIRGSJFUSA-N |
| XLogP | 1.35 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |