C23H26N4O2Si — CID 102001077
(3R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-3-phenoxycyclohex-4-ene-1,1,2,2-tetracarbonitrile (PubChem CID 102001077) has the molecular formula C23H26N4O2Si and a molecular weight of 418.57 g/mol. Its IUPAC name is (3R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-3-phenoxycyclohex-4-ene-1,1,2,2-tetracarbonitrile.
| Compound Name | (3R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-3-phenoxycyclohex-4-ene-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 102001077 |
| Molecular Formula | C23H26N4O2Si |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (3R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-3-phenoxycyclohex-4-ene-1,1,2,2-tetracarbonitrile |
| SMILES | C[C@@H]1C=C(O[Si](C)(C)C(C)(C)C)[C@H](Oc2ccccc2)C(C#N)(C#N)C1(C#N)C#N |
| InChI | InChI=1S/C23H26N4O2Si/c1-17-12-19(29-30(5,6)21(2,3)4)20(28-18-10-8-7-9-11-18)23(15-26,16-27)22(17,13-24)14-25/h7-12,17,20H,1-6H3/t17-,20+/m1/s1 |
| InChIKey | XSEIINLXIPIGKQ-XLIONFOSSA-N |
| XLogP | 5.06 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|