C8H18O3 — CID 102001300
(2R,4R)-5,5-dimethylhexane-1,2,4-triol (PubChem CID 102001300) has the molecular formula C8H18O3 and a molecular weight of 162.23 g/mol. Its IUPAC name is (2R,4R)-5,5-dimethylhexane-1,2,4-triol.
| Compound Name | (2R,4R)-5,5-dimethylhexane-1,2,4-triol |
|---|---|
| PubChem CID | 102001300 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | (2R,4R)-5,5-dimethylhexane-1,2,4-triol |
| SMILES | CC(C)(C)[C@H](O)C[C@@H](O)CO |
| InChI | InChI=1S/C8H18O3/c1-8(2,3)7(11)4-6(10)5-9/h6-7,9-11H,4-5H2,1-3H3/t6-,7-/m1/s1 |
| InChIKey | QLSOOCKESYOANY-RNFRBKRXSA-N |
| XLogP | 0.14 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |