About 7-(2-chloro-4-methoxyphenyl)-2-ethyl-N,N-dipropylpyrazolo[1,5-a]pyridin-3-amine
7-(2-chloro-4-methoxyphenyl)-2-ethyl-N,N-dipropylpyrazolo[1,5-a]pyridin-3-amine (PubChem CID 10200135) has the molecular formula C22H28ClN3O
and a molecular weight of 385.94 g/mol. Its IUPAC name is 7-(2-chloro-4-methoxyphenyl)-2-ethyl-N,N-dipropylpyrazolo[1,5-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 7-(2-chloro-4-methoxyphenyl)-2-ethyl-N,N-dipropylpyrazolo[1,5-a]pyridin-3-amine |
| PubChem CID | 10200135 |
| Molecular Formula | C22H28ClN3O |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 7-(2-chloro-4-methoxyphenyl)-2-ethyl-N,N-dipropylpyrazolo[1,5-a]pyridin-3-amine |
| SMILES | CCCN(CCC)c1c(CC)nn2c(-c3ccc(OC)cc3Cl)cccc12 |
| InChI | InChI=1S/C22H28ClN3O/c1-5-13-25(14-6-2)22-19(7-3)24-26-20(9-8-10-21(22)26)17-12-11-16(27-4)15-18(17)23/h8-12,15H,5-7,13-14H2,1-4H3 |
| InChIKey | DRWYUCDDLDWYEY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(2-chloro-4-methoxyphenyl)-2-ethyl-N,N-dipropylpyrazolo[1,5-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-chloro-4-methoxyphenyl)-2-ethyl-N,N-dipropylpyrazolo[1,5-a]pyridin-3-amine?
The IUPAC name of 7-(2-chloro-4-methoxyphenyl)-2-ethyl-N,N-dipropylpyrazolo[1,5-a]pyridin-3-amine (CID 10200135) is 7-(2-chloro-4-methoxyphenyl)-2-ethyl-N,N-dipropylpyrazolo[1,5-a]pyridin-3-amine.
What is the SMILES notation for 7-(2-chloro-4-methoxyphenyl)-2-ethyl-N,N-dipropylpyrazolo[1,5-a]pyridin-3-amine?
The canonical SMILES for 7-(2-chloro-4-methoxyphenyl)-2-ethyl-N,N-dipropylpyrazolo[1,5-a]pyridin-3-amine is CCCN(CCC)c1c(CC)nn2c(-c3ccc(OC)cc3Cl)cccc12.
What is the InChIKey of 7-(2-chloro-4-methoxyphenyl)-2-ethyl-N,N-dipropylpyrazolo[1,5-a]pyridin-3-amine?
The InChIKey is DRWYUCDDLDWYEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28ClN3O/c1-5-13-25(14-6-2)22-19(7-3)24-26-20(9-8-10-21(22)26)17-12-11-16(27-4)15-18(17)23/h8-12,15H,5-7,13-14H2,1-4H3.
What are the key properties of 7-(2-chloro-4-methoxyphenyl)-2-ethyl-N,N-dipropylpyrazolo[1,5-a]pyridin-3-amine?
7-(2-chloro-4-methoxyphenyl)-2-ethyl-N,N-dipropylpyrazolo[1,5-a]pyridin-3-amine has a molecular weight of 385.94 g/mol, XLogP of 5.85, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-chloro-4-methoxyphenyl)-2-ethyl-N,N-dipropylpyrazolo[1,5-a]pyridin-3-amine is sourced from PubChem (CID 10200135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).