C28H20ClFO — CID 102001416
(1R,8S,9R)-9-(4-chlorophenyl)-9-fluoro-1,8-diphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 102001416) has the molecular formula C28H20ClFO and a molecular weight of 426.92 g/mol. Its IUPAC name is (1R,8S,9R)-9-(4-chlorophenyl)-9-fluoro-1,8-diphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1R,8S,9R)-9-(4-chlorophenyl)-9-fluoro-1,8-diphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 102001416 |
| Molecular Formula | C28H20ClFO |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (1R,8S,9R)-9-(4-chlorophenyl)-9-fluoro-1,8-diphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | F[C@@]1(c2ccc(Cl)cc2)C[C@]2(c3ccccc3)O[C@@]1(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C28H20ClFO/c29-23-17-15-21(16-18-23)27(30)19-26(20-9-3-1-4-10-20)24-13-7-8-14-25(24)28(27,31-26)22-11-5-2-6-12-22/h1-18H,19H2/t26-,27-,28+/m1/s1 |
| InChIKey | RMIOKGWWMIVACO-FCEKVYKBSA-N |
| XLogP | 7.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |