C19H12O4 — CID 102001615
(1S,16R,17R,21R)-18,20,22-trioxahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaen-19-one (PubChem CID 102001615) has the molecular formula C19H12O4 and a molecular weight of 304.30 g/mol. Its IUPAC name is (1S,16R,17R,21R)-18,20,22-trioxahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaen-19-one.
| Compound Name | (1S,16R,17R,21R)-18,20,22-trioxahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaen-19-one |
|---|---|
| PubChem CID | 102001615 |
| Molecular Formula | C19H12O4 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (1S,16R,17R,21R)-18,20,22-trioxahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaen-19-one |
| SMILES | O=C1O[C@H]2[C@H](O1)[C@H]1O[C@@H]2c2c1c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C19H12O4/c20-19-22-17-15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)16(21-15)18(17)23-19/h1-8,15-18H/t15-,16+,17-,18-/m1/s1 |
| InChIKey | OSUJAXVEEYTXRD-XMTFNYHQSA-N |
| XLogP | 4.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|