About (2,6-difluorophenyl) 2-oxo-2-[tris(2-methylpropyl)silylperoxy]acetate
(2,6-difluorophenyl) 2-oxo-2-[tris(2-methylpropyl)silylperoxy]acetate (PubChem CID 102002469) has the molecular formula C20H30F2O5Si
and a molecular weight of 416.54 g/mol. Its IUPAC name is (2,6-difluorophenyl) 2-oxo-2-[tris(2-methylpropyl)silylperoxy]acetate.
Molecular Properties
| Compound Name | (2,6-difluorophenyl) 2-oxo-2-[tris(2-methylpropyl)silylperoxy]acetate |
| PubChem CID | 102002469 |
| Molecular Formula | C20H30F2O5Si |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2,6-difluorophenyl) 2-oxo-2-[tris(2-methylpropyl)silylperoxy]acetate |
| SMILES | CC(C)C[Si](CC(C)C)(CC(C)C)OOC(=O)C(=O)Oc1c(F)cccc1F |
| InChI | InChI=1S/C20H30F2O5Si/c1-13(2)10-28(11-14(3)4,12-15(5)6)27-26-20(24)19(23)25-18-16(21)8-7-9-17(18)22/h7-9,13-15H,10-12H2,1-6H3 |
| InChIKey | GELVOJLSPABCPQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,6-difluorophenyl) 2-oxo-2-[tris(2-methylpropyl)silylperoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-difluorophenyl) 2-oxo-2-[tris(2-methylpropyl)silylperoxy]acetate?
The IUPAC name of (2,6-difluorophenyl) 2-oxo-2-[tris(2-methylpropyl)silylperoxy]acetate (CID 102002469) is (2,6-difluorophenyl) 2-oxo-2-[tris(2-methylpropyl)silylperoxy]acetate.
What is the SMILES notation for (2,6-difluorophenyl) 2-oxo-2-[tris(2-methylpropyl)silylperoxy]acetate?
The canonical SMILES for (2,6-difluorophenyl) 2-oxo-2-[tris(2-methylpropyl)silylperoxy]acetate is CC(C)C[Si](CC(C)C)(CC(C)C)OOC(=O)C(=O)Oc1c(F)cccc1F.
What is the InChIKey of (2,6-difluorophenyl) 2-oxo-2-[tris(2-methylpropyl)silylperoxy]acetate?
The InChIKey is GELVOJLSPABCPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30F2O5Si/c1-13(2)10-28(11-14(3)4,12-15(5)6)27-26-20(24)19(23)25-18-16(21)8-7-9-17(18)22/h7-9,13-15H,10-12H2,1-6H3.
What are the key properties of (2,6-difluorophenyl) 2-oxo-2-[tris(2-methylpropyl)silylperoxy]acetate?
(2,6-difluorophenyl) 2-oxo-2-[tris(2-methylpropyl)silylperoxy]acetate has a molecular weight of 416.54 g/mol, XLogP of 5.26, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-difluorophenyl) 2-oxo-2-[tris(2-methylpropyl)silylperoxy]acetate is sourced from PubChem (CID 102002469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).