C31H38O4Si — CID 102002828
methyl 2-[(1S,3aS,6aS)-3a-methyl-6-methylidene-1,4,5,6a-tetrahydropentalen-1-yl]-4-[tert-butyl(diphenyl)silyl]oxy-3-oxobutanoate (PubChem CID 102002828) has the molecular formula C31H38O4Si and a molecular weight of 502.73 g/mol. Its IUPAC name is methyl 2-[(1S,3aS,6aS)-3a-methyl-6-methylidene-1,4,5,6a-tetrahydropentalen-1-yl]-4-[tert-butyl(diphenyl)silyl]oxy-3-oxobutanoate.
| Compound Name | methyl 2-[(1S,3aS,6aS)-3a-methyl-6-methylidene-1,4,5,6a-tetrahydropentalen-1-yl]-4-[tert-butyl(diphenyl)silyl]oxy-3-oxobutanoate |
|---|---|
| PubChem CID | 102002828 |
| Molecular Formula | C31H38O4Si |
| Molecular Weight | 502.73 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | methyl 2-[(1S,3aS,6aS)-3a-methyl-6-methylidene-1,4,5,6a-tetrahydropentalen-1-yl]-4-[tert-butyl(diphenyl)silyl]oxy-3-oxobutanoate |
| SMILES | C=C1CC[C@@]2(C)C=C[C@H](C(C(=O)CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C(=O)OC)[C@@H]12 |
| InChI | InChI=1S/C31H38O4Si/c1-22-17-19-31(5)20-18-25(28(22)31)27(29(33)34-6)26(32)21-35-36(30(2,3)4,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,18,20,25,27-28H,1,17,19,21H2,2-6H3/t25-,27?,28-,31+/m1/s1 |
| InChIKey | JNJJZNJMWXQWLR-YTXDOLHBSA-N |
| XLogP | 5.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.73 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|