C20H24NOP — CID 102002966
(5S)-5-(diphenylphosphanylmethyl)-1,3,3-trimethylpyrrolidin-2-one (PubChem CID 102002966) has the molecular formula C20H24NOP and a molecular weight of 325.39 g/mol. Its IUPAC name is (5S)-5-(diphenylphosphanylmethyl)-1,3,3-trimethylpyrrolidin-2-one.
| Compound Name | (5S)-5-(diphenylphosphanylmethyl)-1,3,3-trimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 102002966 |
| Molecular Formula | C20H24NOP |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (5S)-5-(diphenylphosphanylmethyl)-1,3,3-trimethylpyrrolidin-2-one |
| SMILES | CN1C(=O)C(C)(C)C[C@H]1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24NOP/c1-20(2)14-16(21(3)19(20)22)15-23(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,16H,14-15H2,1-3H3/t16-/m0/s1 |
| InChIKey | XTTROFUXDRBGAI-INIZCTEOSA-N |
| XLogP | 3.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|