About [(E)-4-phenylmethoxybut-2-enyl] 2-diazoacetate
[(E)-4-phenylmethoxybut-2-enyl] 2-diazoacetate (PubChem CID 102003320) has the molecular formula C13H14N2O3
and a molecular weight of 246.27 g/mol. Its IUPAC name is [(E)-4-phenylmethoxybut-2-enyl] 2-diazoacetate.
Molecular Properties
| Compound Name | [(E)-4-phenylmethoxybut-2-enyl] 2-diazoacetate |
| PubChem CID | 102003320 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | [(E)-4-phenylmethoxybut-2-enyl] 2-diazoacetate |
| SMILES | [N-]=[N+]=CC(=O)OC/C=C/COCc1ccccc1 |
| InChI | InChI=1S/C13H14N2O3/c14-15-10-13(16)18-9-5-4-8-17-11-12-6-2-1-3-7-12/h1-7,10H,8-9,11H2/b5-4+ |
| InChIKey | RKHKQPZGGURGPQ-SNAWJCMRSA-N |
| XLogP | 1.60 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4-phenylmethoxybut-2-enyl] 2-diazoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4-phenylmethoxybut-2-enyl] 2-diazoacetate?
The IUPAC name of [(E)-4-phenylmethoxybut-2-enyl] 2-diazoacetate (CID 102003320) is [(E)-4-phenylmethoxybut-2-enyl] 2-diazoacetate.
What is the SMILES notation for [(E)-4-phenylmethoxybut-2-enyl] 2-diazoacetate?
The canonical SMILES for [(E)-4-phenylmethoxybut-2-enyl] 2-diazoacetate is [N-]=[N+]=CC(=O)OC/C=C/COCc1ccccc1.
What is the InChIKey of [(E)-4-phenylmethoxybut-2-enyl] 2-diazoacetate?
The InChIKey is RKHKQPZGGURGPQ-SNAWJCMRSA-N. The full InChI is InChI=1S/C13H14N2O3/c14-15-10-13(16)18-9-5-4-8-17-11-12-6-2-1-3-7-12/h1-7,10H,8-9,11H2/b5-4+.
What are the key properties of [(E)-4-phenylmethoxybut-2-enyl] 2-diazoacetate?
[(E)-4-phenylmethoxybut-2-enyl] 2-diazoacetate has a molecular weight of 246.27 g/mol, XLogP of 1.60, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4-phenylmethoxybut-2-enyl] 2-diazoacetate is sourced from PubChem (CID 102003320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).