C17H23NO — CID 102003343
1-[(3S,4R)-1-benzyl-3-ethenylpiperidin-4-yl]propan-2-one (PubChem CID 102003343) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-[(3S,4R)-1-benzyl-3-ethenylpiperidin-4-yl]propan-2-one.
| Compound Name | 1-[(3S,4R)-1-benzyl-3-ethenylpiperidin-4-yl]propan-2-one |
|---|---|
| PubChem CID | 102003343 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 1-[(3S,4R)-1-benzyl-3-ethenylpiperidin-4-yl]propan-2-one |
| SMILES | C=C[C@@H]1CN(Cc2ccccc2)CC[C@@H]1CC(C)=O |
| InChI | InChI=1S/C17H23NO/c1-3-16-13-18(10-9-17(16)11-14(2)19)12-15-7-5-4-6-8-15/h3-8,16-17H,1,9-13H2,2H3/t16-,17-/m1/s1 |
| InChIKey | ZIIQNNUYEOBIMU-IAGOWNOFSA-N |
| XLogP | 3.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|