About [chloro(diphenyl)-λ5-phosphanylidene]-ditert-butylphosphoryl-oxidophosphanium
[chloro(diphenyl)-λ5-phosphanylidene]-ditert-butylphosphoryl-oxidophosphanium (PubChem CID 102003483) has the molecular formula C20H28ClO2P3
and a molecular weight of 428.82 g/mol. Its IUPAC name is [chloro(diphenyl)-λ5-phosphanylidene]-ditert-butylphosphoryl-oxidophosphanium.
Molecular Properties
| Compound Name | [chloro(diphenyl)-λ5-phosphanylidene]-ditert-butylphosphoryl-oxidophosphanium |
| PubChem CID | 102003483 |
| Molecular Formula | C20H28ClO2P3 |
| Molecular Weight | 428.82 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [chloro(diphenyl)-λ5-phosphanylidene]-ditert-butylphosphoryl-oxidophosphanium |
| SMILES | CC(C)(C)P(=O)([P+]([O-])=P(Cl)(c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C20H28ClO2P3/c1-19(2,3)26(23,20(4,5)6)24(22)25(21,17-13-9-7-10-14-17)18-15-11-8-12-16-18/h7-16H,1-6H3 |
| InChIKey | VPQYJEOCMHWMJY-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.82 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [chloro(diphenyl)-λ5-phosphanylidene]-ditert-butylphosphoryl-oxidophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [chloro(diphenyl)-λ5-phosphanylidene]-ditert-butylphosphoryl-oxidophosphanium?
The IUPAC name of [chloro(diphenyl)-λ5-phosphanylidene]-ditert-butylphosphoryl-oxidophosphanium (CID 102003483) is [chloro(diphenyl)-λ5-phosphanylidene]-ditert-butylphosphoryl-oxidophosphanium.
What is the SMILES notation for [chloro(diphenyl)-λ5-phosphanylidene]-ditert-butylphosphoryl-oxidophosphanium?
The canonical SMILES for [chloro(diphenyl)-λ5-phosphanylidene]-ditert-butylphosphoryl-oxidophosphanium is CC(C)(C)P(=O)([P+]([O-])=P(Cl)(c1ccccc1)c1ccccc1)C(C)(C)C.
What is the InChIKey of [chloro(diphenyl)-λ5-phosphanylidene]-ditert-butylphosphoryl-oxidophosphanium?
The InChIKey is VPQYJEOCMHWMJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28ClO2P3/c1-19(2,3)26(23,20(4,5)6)24(22)25(21,17-13-9-7-10-14-17)18-15-11-8-12-16-18/h7-16H,1-6H3.
What are the key properties of [chloro(diphenyl)-λ5-phosphanylidene]-ditert-butylphosphoryl-oxidophosphanium?
[chloro(diphenyl)-λ5-phosphanylidene]-ditert-butylphosphoryl-oxidophosphanium has a molecular weight of 428.82 g/mol, XLogP of 6.36, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [chloro(diphenyl)-λ5-phosphanylidene]-ditert-butylphosphoryl-oxidophosphanium is sourced from PubChem (CID 102003483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).