C16H20GeSi — CID 102004148
trimethyl-[(E)-10-trimethylgermyldec-5-en-1,3,7,9-tetraynyl]silane (PubChem CID 102004148) has the molecular formula C16H20GeSi and a molecular weight of 313.03 g/mol. Its IUPAC name is trimethyl-[(E)-10-trimethylgermyldec-5-en-1,3,7,9-tetraynyl]silane.
| Compound Name | trimethyl-[(E)-10-trimethylgermyldec-5-en-1,3,7,9-tetraynyl]silane |
|---|---|
| PubChem CID | 102004148 |
| Molecular Formula | C16H20GeSi |
| Molecular Weight | 313.03 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | trimethyl-[(E)-10-trimethylgermyldec-5-en-1,3,7,9-tetraynyl]silane |
| SMILES | C[Si](C)(C)C#CC#C/C=C/C#CC#C[Ge](C)(C)C |
| InChI | InChI=1S/C16H20GeSi/c1-17(2,3)15-13-11-9-7-8-10-12-14-16-18(4,5)6/h7-8H,1-6H3/b8-7+ |
| InChIKey | RPRHWBFLMRQUEF-BQYQJAHWSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.03 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|