C6H9N3O4 — CID 102004268
5-ethyl-5-(hydroxyamino)-1,3-diazinane-2,4,6-trione (PubChem CID 102004268) has the molecular formula C6H9N3O4 and a molecular weight of 187.15 g/mol. Its IUPAC name is 5-ethyl-5-(hydroxyamino)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-ethyl-5-(hydroxyamino)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 102004268 |
| Molecular Formula | C6H9N3O4 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 5-ethyl-5-(hydroxyamino)-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(NO)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C6H9N3O4/c1-2-6(9-13)3(10)7-5(12)8-4(6)11/h9,13H,2H2,1H3,(H2,7,8,10,11,12) |
| InChIKey | XKRDFVVBBDOPEI-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|