C13H8F6OS — CID 102004321
1,1,1,3,3,3-hexafluoro-2-(4-thiophen-2-ylphenyl)propan-2-ol (PubChem CID 102004321) has the molecular formula C13H8F6OS and a molecular weight of 326.26 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(4-thiophen-2-ylphenyl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(4-thiophen-2-ylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 102004321 |
| Molecular Formula | C13H8F6OS |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(4-thiophen-2-ylphenyl)propan-2-ol |
| SMILES | OC(c1ccc(-c2cccs2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H8F6OS/c14-12(15,16)11(20,13(17,18)19)9-5-3-8(4-6-9)10-2-1-7-21-10/h1-7,20H |
| InChIKey | KRGKTAXURNFQII-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |