About N-(4-benzoylphenyl)-2,4,5-trimethoxybenzamide
N-(4-benzoylphenyl)-2,4,5-trimethoxybenzamide (PubChem CID 1020050) has the molecular formula C23H21NO5
and a molecular weight of 391.42 g/mol. Its IUPAC name is N-(4-benzoylphenyl)-2,4,5-trimethoxybenzamide.
Molecular Properties
| Compound Name | N-(4-benzoylphenyl)-2,4,5-trimethoxybenzamide |
| PubChem CID | 1020050 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-(4-benzoylphenyl)-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2ccc(C(=O)c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C23H21NO5/c1-27-19-14-21(29-3)20(28-2)13-18(19)23(26)24-17-11-9-16(10-12-17)22(25)15-7-5-4-6-8-15/h4-14H,1-3H3,(H,24,26) |
| InChIKey | MFOQBEVOGHQNMU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-benzoylphenyl)-2,4,5-trimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-benzoylphenyl)-2,4,5-trimethoxybenzamide?
The IUPAC name of N-(4-benzoylphenyl)-2,4,5-trimethoxybenzamide (CID 1020050) is N-(4-benzoylphenyl)-2,4,5-trimethoxybenzamide.
What is the SMILES notation for N-(4-benzoylphenyl)-2,4,5-trimethoxybenzamide?
The canonical SMILES for N-(4-benzoylphenyl)-2,4,5-trimethoxybenzamide is COc1cc(OC)c(C(=O)Nc2ccc(C(=O)c3ccccc3)cc2)cc1OC.
What is the InChIKey of N-(4-benzoylphenyl)-2,4,5-trimethoxybenzamide?
The InChIKey is MFOQBEVOGHQNMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO5/c1-27-19-14-21(29-3)20(28-2)13-18(19)23(26)24-17-11-9-16(10-12-17)22(25)15-7-5-4-6-8-15/h4-14H,1-3H3,(H,24,26).
What are the key properties of N-(4-benzoylphenyl)-2,4,5-trimethoxybenzamide?
N-(4-benzoylphenyl)-2,4,5-trimethoxybenzamide has a molecular weight of 391.42 g/mol, XLogP of 4.20, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-benzoylphenyl)-2,4,5-trimethoxybenzamide is sourced from PubChem (CID 1020050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).