C20H23IN2O2 — CID 102005475
(E)-3-[5-(dimethylamino)-2-[[4-(dimethylamino)-2-iodophenyl]methyl]phenyl]prop-2-enoic acid (PubChem CID 102005475) has the molecular formula C20H23IN2O2 and a molecular weight of 450.32 g/mol. Its IUPAC name is (E)-3-[5-(dimethylamino)-2-[[4-(dimethylamino)-2-iodophenyl]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(dimethylamino)-2-[[4-(dimethylamino)-2-iodophenyl]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102005475 |
| Molecular Formula | C20H23IN2O2 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | (E)-3-[5-(dimethylamino)-2-[[4-(dimethylamino)-2-iodophenyl]methyl]phenyl]prop-2-enoic acid |
| SMILES | CN(C)c1ccc(Cc2ccc(N(C)C)cc2/C=C/C(=O)O)c(I)c1 |
| InChI | InChI=1S/C20H23IN2O2/c1-22(2)17-8-5-14(15(12-17)7-10-20(24)25)11-16-6-9-18(23(3)4)13-19(16)21/h5-10,12-13H,11H2,1-4H3,(H,24,25)/b10-7+ |
| InChIKey | AFQMFOXNSVXWCS-JXMROGBWSA-N |
| XLogP | 4.11 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|