C18H31BO6 — CID 102005643
dipropan-2-yl 2-[(1R,2R)-2-pentylcyclopropyl]-1,3,2-dioxaborolane-4,5-dicarboxylate (PubChem CID 102005643) has the molecular formula C18H31BO6 and a molecular weight of 354.25 g/mol. Its IUPAC name is dipropan-2-yl 2-[(1R,2R)-2-pentylcyclopropyl]-1,3,2-dioxaborolane-4,5-dicarboxylate.
| Compound Name | dipropan-2-yl 2-[(1R,2R)-2-pentylcyclopropyl]-1,3,2-dioxaborolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102005643 |
| Molecular Formula | C18H31BO6 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | dipropan-2-yl 2-[(1R,2R)-2-pentylcyclopropyl]-1,3,2-dioxaborolane-4,5-dicarboxylate |
| SMILES | CCCCC[C@@H]1C[C@H]1B1OC(C(=O)OC(C)C)C(C(=O)OC(C)C)O1 |
| InChI | InChI=1S/C18H31BO6/c1-6-7-8-9-13-10-14(13)19-24-15(17(20)22-11(2)3)16(25-19)18(21)23-12(4)5/h11-16H,6-10H2,1-5H3/t13-,14-,15?,16?/m1/s1 |
| InChIKey | PZXWGHCSTMSRAY-WXLSXGNJSA-N |
| XLogP | 3.13 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|