C12H10S — CID 102005676
1-phenylsulfanyl-2,3,4,5,6-pentatritiobenzene (PubChem CID 102005676) has the molecular formula C12H10S and a molecular weight of 196.32 g/mol. Its IUPAC name is 1-phenylsulfanyl-2,3,4,5,6-pentatritiobenzene.
| Compound Name | 1-phenylsulfanyl-2,3,4,5,6-pentatritiobenzene |
|---|---|
| PubChem CID | 102005676 |
| Molecular Formula | C12H10S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 1-phenylsulfanyl-2,3,4,5,6-pentatritiobenzene |
| SMILES | [3H]c1c([3H])c([3H])c(Sc2ccccc2)c([3H])c1[3H] |
| InChI | InChI=1S/C12H10S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H/i1T,3T,4T,7T,8T |
| InChIKey | LTYMSROWYAPPGB-XSRMNTKQSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |