C30H54O2Si2 — CID 102005752
(4R,5R)-4,5-bis[2-tri(propan-2-yl)silylethynyl]octa-1,7-diene-4,5-diol (PubChem CID 102005752) has the molecular formula C30H54O2Si2 and a molecular weight of 502.93 g/mol. Its IUPAC name is (4R,5R)-4,5-bis[2-tri(propan-2-yl)silylethynyl]octa-1,7-diene-4,5-diol.
| Compound Name | (4R,5R)-4,5-bis[2-tri(propan-2-yl)silylethynyl]octa-1,7-diene-4,5-diol |
|---|---|
| PubChem CID | 102005752 |
| Molecular Formula | C30H54O2Si2 |
| Molecular Weight | 502.93 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | (4R,5R)-4,5-bis[2-tri(propan-2-yl)silylethynyl]octa-1,7-diene-4,5-diol |
| SMILES | C=CC[C@@](O)(C#C[Si](C(C)C)(C(C)C)C(C)C)[C@](O)(C#C[Si](C(C)C)(C(C)C)C(C)C)CC=C |
| InChI | InChI=1S/C30H54O2Si2/c1-15-17-29(31,19-21-33(23(3)4,24(5)6)25(7)8)30(32,18-16-2)20-22-34(26(9)10,27(11)12)28(13)14/h15-16,23-28,31-32H,1-2,17-18H2,3-14H3/t29-,30-/m1/s1 |
| InChIKey | UCZRWEZRQBQKCG-LOYHVIPDSA-N |
| XLogP | 8.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.93 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|