About 3,5-dimethyl-N,N-bis(trimethylsilyl)aniline
3,5-dimethyl-N,N-bis(trimethylsilyl)aniline (PubChem CID 102006191) has the molecular formula C14H27NSi2
and a molecular weight of 265.55 g/mol. Its IUPAC name is 3,5-dimethyl-N,N-bis(trimethylsilyl)aniline.
Molecular Properties
| Compound Name | 3,5-dimethyl-N,N-bis(trimethylsilyl)aniline |
| PubChem CID | 102006191 |
| Molecular Formula | C14H27NSi2 |
| Molecular Weight | 265.55 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 3,5-dimethyl-N,N-bis(trimethylsilyl)aniline |
| SMILES | Cc1cc(C)cc(N([Si](C)(C)C)[Si](C)(C)C)c1 |
| InChI | InChI=1S/C14H27NSi2/c1-12-9-13(2)11-14(10-12)15(16(3,4)5)17(6,7)8/h9-11H,1-8H3 |
| InChIKey | SMKMFYVKVQVTLU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-N,N-bis(trimethylsilyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-N,N-bis(trimethylsilyl)aniline?
The IUPAC name of 3,5-dimethyl-N,N-bis(trimethylsilyl)aniline (CID 102006191) is 3,5-dimethyl-N,N-bis(trimethylsilyl)aniline.
What is the SMILES notation for 3,5-dimethyl-N,N-bis(trimethylsilyl)aniline?
The canonical SMILES for 3,5-dimethyl-N,N-bis(trimethylsilyl)aniline is Cc1cc(C)cc(N([Si](C)(C)C)[Si](C)(C)C)c1.
What is the InChIKey of 3,5-dimethyl-N,N-bis(trimethylsilyl)aniline?
The InChIKey is SMKMFYVKVQVTLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NSi2/c1-12-9-13(2)11-14(10-12)15(16(3,4)5)17(6,7)8/h9-11H,1-8H3.
What are the key properties of 3,5-dimethyl-N,N-bis(trimethylsilyl)aniline?
3,5-dimethyl-N,N-bis(trimethylsilyl)aniline has a molecular weight of 265.55 g/mol, XLogP of 4.78, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-N,N-bis(trimethylsilyl)aniline is sourced from PubChem (CID 102006191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).