C18H22F4O2Si2 — CID 102006217
hydroxy-dimethyl-[3-[1,1,2,2-tetrafluoro-2-[3-[hydroxy(dimethyl)silyl]phenyl]ethyl]phenyl]silane (PubChem CID 102006217) has the molecular formula C18H22F4O2Si2 and a molecular weight of 402.54 g/mol. Its IUPAC name is hydroxy-dimethyl-[3-[1,1,2,2-tetrafluoro-2-[3-[hydroxy(dimethyl)silyl]phenyl]ethyl]phenyl]silane.
| Compound Name | hydroxy-dimethyl-[3-[1,1,2,2-tetrafluoro-2-[3-[hydroxy(dimethyl)silyl]phenyl]ethyl]phenyl]silane |
|---|---|
| PubChem CID | 102006217 |
| Molecular Formula | C18H22F4O2Si2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | hydroxy-dimethyl-[3-[1,1,2,2-tetrafluoro-2-[3-[hydroxy(dimethyl)silyl]phenyl]ethyl]phenyl]silane |
| SMILES | C[Si](C)(O)c1cccc(C(F)(F)C(F)(F)c2cccc([Si](C)(C)O)c2)c1 |
| InChI | InChI=1S/C18H22F4O2Si2/c1-25(2,23)15-9-5-7-13(11-15)17(19,20)18(21,22)14-8-6-10-16(12-14)26(3,4)24/h5-12,23-24H,1-4H3 |
| InChIKey | KMOPCTMZZDLONP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|