C16H14N2O4 — CID 102006402
5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione (PubChem CID 102006402) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione.
| Compound Name | 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione |
|---|---|
| PubChem CID | 102006402 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione |
| SMILES | CON1C(=O)c2ccccc2N(OC)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H14N2O4/c1-21-17-13-9-5-3-7-11(13)16(20)18(22-2)14-10-6-4-8-12(14)15(17)19/h3-10H,1-2H3 |
| InChIKey | PZGGWEWXUFMFSD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |