About 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione
5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione (PubChem CID 102006402) has the molecular formula C16H14N2O4
and a molecular weight of 298.30 g/mol. Its IUPAC name is 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione.
Molecular Properties
| Compound Name | 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione |
| PubChem CID | 102006402 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione |
| SMILES | CON1C(=O)c2ccccc2N(OC)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H14N2O4/c1-21-17-13-9-5-3-7-11(13)16(20)18(22-2)14-10-6-4-8-12(14)15(17)19/h3-10H,1-2H3 |
| InChIKey | PZGGWEWXUFMFSD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione?
The IUPAC name of 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione (CID 102006402) is 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione.
What is the SMILES notation for 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione?
The canonical SMILES for 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione is CON1C(=O)c2ccccc2N(OC)C(=O)c2ccccc21.
What is the InChIKey of 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione?
The InChIKey is PZGGWEWXUFMFSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O4/c1-21-17-13-9-5-3-7-11(13)16(20)18(22-2)14-10-6-4-8-12(14)15(17)19/h3-10H,1-2H3.
What are the key properties of 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione?
5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione has a molecular weight of 298.30 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,11-dimethoxybenzo[c][1,5]benzodiazocine-6,12-dione is sourced from PubChem (CID 102006402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).