C6H7N2NaO3S — CID 102006544
sodium N-(5-methyl-2-pyridinyl)sulfamate (PubChem CID 102006544) has the molecular formula C6H7N2NaO3S and a molecular weight of 210.19 g/mol. Its IUPAC name is sodium N-(5-methyl-2-pyridinyl)sulfamate.
| Compound Name | sodium N-(5-methyl-2-pyridinyl)sulfamate |
|---|---|
| PubChem CID | 102006544 |
| Molecular Formula | C6H7N2NaO3S |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | sodium N-(5-methyl-2-pyridinyl)sulfamate |
| SMILES | Cc1ccc(NS(=O)(=O)[O-])nc1.[Na+] |
| InChI | InChI=1S/C6H8N2O3S.Na/c1-5-2-3-6(7-4-5)8-12(9,10)11;/h2-4H,1H3,(H,7,8)(H,9,10,11);/q;+1/p-1 |
| InChIKey | ISZWZVPDXDEUGN-UHFFFAOYSA-M |
| XLogP | -2.73 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|