About sodium N-[2,6-bis(trifluoromethyl)-4-pyridinyl]sulfamate
sodium N-[2,6-bis(trifluoromethyl)-4-pyridinyl]sulfamate (PubChem CID 102006553) has the molecular formula C7H3F6N2NaO3S
and a molecular weight of 332.16 g/mol. Its IUPAC name is sodium N-[2,6-bis(trifluoromethyl)-4-pyridinyl]sulfamate.
Molecular Properties
| Compound Name | sodium N-[2,6-bis(trifluoromethyl)-4-pyridinyl]sulfamate |
| PubChem CID | 102006553 |
| Molecular Formula | C7H3F6N2NaO3S |
| Molecular Weight | 332.16 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | sodium N-[2,6-bis(trifluoromethyl)-4-pyridinyl]sulfamate |
| SMILES | O=S(=O)([O-])Nc1cc(C(F)(F)F)nc(C(F)(F)F)c1.[Na+] |
| InChI | InChI=1S/C7H4F6N2O3S.Na/c8-6(9,10)4-1-3(15-19(16,17)18)2-5(14-4)7(11,12)13;/h1-2H,(H,14,15)(H,16,17,18);/q;+1/p-1 |
| InChIKey | SSQAYFPPMNPGQG-UHFFFAOYSA-M |
| XLogP | -1.00 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.16 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium N-[2,6-bis(trifluoromethyl)-4-pyridinyl]sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium N-[2,6-bis(trifluoromethyl)-4-pyridinyl]sulfamate?
The IUPAC name of sodium N-[2,6-bis(trifluoromethyl)-4-pyridinyl]sulfamate (CID 102006553) is sodium N-[2,6-bis(trifluoromethyl)-4-pyridinyl]sulfamate.
What is the SMILES notation for sodium N-[2,6-bis(trifluoromethyl)-4-pyridinyl]sulfamate?
The canonical SMILES for sodium N-[2,6-bis(trifluoromethyl)-4-pyridinyl]sulfamate is O=S(=O)([O-])Nc1cc(C(F)(F)F)nc(C(F)(F)F)c1.[Na+].
What is the InChIKey of sodium N-[2,6-bis(trifluoromethyl)-4-pyridinyl]sulfamate?
The InChIKey is SSQAYFPPMNPGQG-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H4F6N2O3S.Na/c8-6(9,10)4-1-3(15-19(16,17)18)2-5(14-4)7(11,12)13;/h1-2H,(H,14,15)(H,16,17,18);/q;+1/p-1.
What are the key properties of sodium N-[2,6-bis(trifluoromethyl)-4-pyridinyl]sulfamate?
sodium N-[2,6-bis(trifluoromethyl)-4-pyridinyl]sulfamate has a molecular weight of 332.16 g/mol, XLogP of -1.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N-[2,6-bis(trifluoromethyl)-4-pyridinyl]sulfamate is sourced from PubChem (CID 102006553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).