C16H24O3 — CID 102007080
(1R,2S,3S,7R,8S,9S,13R)-7-(hydroxymethyl)-5,11-dimethylidenetricyclo[7.3.1.02,8]tridecane-3,13-diol (PubChem CID 102007080) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (1R,2S,3S,7R,8S,9S,13R)-7-(hydroxymethyl)-5,11-dimethylidenetricyclo[7.3.1.02,8]tridecane-3,13-diol.
| Compound Name | (1R,2S,3S,7R,8S,9S,13R)-7-(hydroxymethyl)-5,11-dimethylidenetricyclo[7.3.1.02,8]tridecane-3,13-diol |
|---|---|
| PubChem CID | 102007080 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (1R,2S,3S,7R,8S,9S,13R)-7-(hydroxymethyl)-5,11-dimethylidenetricyclo[7.3.1.02,8]tridecane-3,13-diol |
| SMILES | C=C1C[C@@H]2[C@@H](O)[C@H](C1)[C@@H]1[C@H]2[C@H](CO)CC(=C)C[C@@H]1O |
| InChI | InChI=1S/C16H24O3/c1-8-3-10(7-17)14-11-4-9(2)5-12(16(11)19)15(14)13(18)6-8/h10-19H,1-7H2/t10-,11-,12+,13-,14-,15-,16+/m0/s1 |
| InChIKey | PMZWLHJNQSCMER-NDTOZGPPSA-N |
| XLogP | 1.50 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|