C11H16O — CID 102007298
1-[(2S,3R)-3-deuteriobutan-2-yl]-2-methoxybenzene (PubChem CID 102007298) has the molecular formula C11H16O and a molecular weight of 165.25 g/mol. Its IUPAC name is 1-[(2S,3R)-3-deuteriobutan-2-yl]-2-methoxybenzene.
| Compound Name | 1-[(2S,3R)-3-deuteriobutan-2-yl]-2-methoxybenzene |
|---|---|
| PubChem CID | 102007298 |
| Molecular Formula | C11H16O |
| Molecular Weight | 165.25 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1-[(2S,3R)-3-deuteriobutan-2-yl]-2-methoxybenzene |
| SMILES | [2H][C@H](C)[C@H](C)c1ccccc1OC |
| InChI | InChI=1S/C11H16O/c1-4-9(2)10-7-5-6-8-11(10)12-3/h5-9H,4H2,1-3H3/t9-/m0/s1/i4D/t4-,9+/m1 |
| InChIKey | XGEOZYQKQHPUFZ-BTSVJFACSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |