About ethyl (5Z)-5-benzylidene-4,7-dioxo-1-oxa-6-azaspiro[2.4]heptane-2-carboxylate
ethyl (5Z)-5-benzylidene-4,7-dioxo-1-oxa-6-azaspiro[2.4]heptane-2-carboxylate (PubChem CID 102007374) has the molecular formula C15H13NO5
and a molecular weight of 287.27 g/mol. Its IUPAC name is ethyl (5Z)-5-benzylidene-4,7-dioxo-1-oxa-6-azaspiro[2.4]heptane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl (5Z)-5-benzylidene-4,7-dioxo-1-oxa-6-azaspiro[2.4]heptane-2-carboxylate |
| PubChem CID | 102007374 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | ethyl (5Z)-5-benzylidene-4,7-dioxo-1-oxa-6-azaspiro[2.4]heptane-2-carboxylate |
| SMILES | CCOC(=O)C1OC12C(=O)N/C(=C\c1ccccc1)C2=O |
| InChI | InChI=1S/C15H13NO5/c1-2-20-13(18)12-15(21-12)11(17)10(16-14(15)19)8-9-6-4-3-5-7-9/h3-8,12H,2H2,1H3,(H,16,19)/b10-8- |
| InChIKey | MQYYLCRNJJEKTK-NTMALXAHSA-N |
| XLogP | 0.43 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethyl (5Z)-5-benzylidene-4,7-dioxo-1-oxa-6-azaspiro[2.4]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (5Z)-5-benzylidene-4,7-dioxo-1-oxa-6-azaspiro[2.4]heptane-2-carboxylate?
The IUPAC name of ethyl (5Z)-5-benzylidene-4,7-dioxo-1-oxa-6-azaspiro[2.4]heptane-2-carboxylate (CID 102007374) is ethyl (5Z)-5-benzylidene-4,7-dioxo-1-oxa-6-azaspiro[2.4]heptane-2-carboxylate.
What is the SMILES notation for ethyl (5Z)-5-benzylidene-4,7-dioxo-1-oxa-6-azaspiro[2.4]heptane-2-carboxylate?
The canonical SMILES for ethyl (5Z)-5-benzylidene-4,7-dioxo-1-oxa-6-azaspiro[2.4]heptane-2-carboxylate is CCOC(=O)C1OC12C(=O)N/C(=C\c1ccccc1)C2=O.
What is the InChIKey of ethyl (5Z)-5-benzylidene-4,7-dioxo-1-oxa-6-azaspiro[2.4]heptane-2-carboxylate?
The InChIKey is MQYYLCRNJJEKTK-NTMALXAHSA-N. The full InChI is InChI=1S/C15H13NO5/c1-2-20-13(18)12-15(21-12)11(17)10(16-14(15)19)8-9-6-4-3-5-7-9/h3-8,12H,2H2,1H3,(H,16,19)/b10-8-.
What are the key properties of ethyl (5Z)-5-benzylidene-4,7-dioxo-1-oxa-6-azaspiro[2.4]heptane-2-carboxylate?
ethyl (5Z)-5-benzylidene-4,7-dioxo-1-oxa-6-azaspiro[2.4]heptane-2-carboxylate has a molecular weight of 287.27 g/mol, XLogP of 0.43, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (5Z)-5-benzylidene-4,7-dioxo-1-oxa-6-azaspiro[2.4]heptane-2-carboxylate is sourced from PubChem (CID 102007374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).