C22H16Br3NO2 — CID 102007450
2,3,5-tribromo-6-[(E)-2-(dibenzylamino)ethenyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 102007450) has the molecular formula C22H16Br3NO2 and a molecular weight of 566.09 g/mol. Its IUPAC name is 2,3,5-tribromo-6-[(E)-2-(dibenzylamino)ethenyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3,5-tribromo-6-[(E)-2-(dibenzylamino)ethenyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 102007450 |
| Molecular Formula | C22H16Br3NO2 |
| Molecular Weight | 566.09 g/mol |
| Exact Mass | 562.87 |
| IUPAC Name | 2,3,5-tribromo-6-[(E)-2-(dibenzylamino)ethenyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C(Br)=C(Br)C(=O)C(/C=C/N(Cc2ccccc2)Cc2ccccc2)=C1Br |
| InChI | InChI=1S/C22H16Br3NO2/c23-18-17(21(27)19(24)20(25)22(18)28)11-12-26(13-15-7-3-1-4-8-15)14-16-9-5-2-6-10-16/h1-12H,13-14H2/b12-11+ |
| InChIKey | JIFPQMYTQGIHCT-VAWYXSNFSA-N |
| XLogP | 6.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.09 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|