C38H35O4PSSi — CID 102007543
tert-butyl-[4-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yloxy)-3-phenylsulfanylphenoxy]-dimethylsilane (PubChem CID 102007543) has the molecular formula C38H35O4PSSi and a molecular weight of 646.82 g/mol. Its IUPAC name is tert-butyl-[4-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yloxy)-3-phenylsulfanylphenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yloxy)-3-phenylsulfanylphenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 102007543 |
| Molecular Formula | C38H35O4PSSi |
| Molecular Weight | 646.82 g/mol |
| Exact Mass | 646.18 |
| IUPAC Name | tert-butyl-[4-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yloxy)-3-phenylsulfanylphenoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(Op2oc3ccc4ccccc4c3c3c(ccc4ccccc43)o2)c(Sc2ccccc2)c1 |
| InChI | InChI=1S/C38H35O4PSSi/c1-38(2,3)45(4,5)42-28-21-24-32(35(25-28)44-29-15-7-6-8-16-29)39-43-40-33-22-19-26-13-9-11-17-30(26)36(33)37-31-18-12-10-14-27(31)20-23-34(37)41-43/h6-25H,1-5H3 |
| InChIKey | RUJKUSZIFWVJSD-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 44.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.82 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|