C17H28O2 — CID 102007696
(3R,4aR,8R,8aR)-3-tert-butyl-5-methyl-8-propan-2-yl-3,4,4a,7,8,8a-hexahydroisochromen-1-one (PubChem CID 102007696) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (3R,4aR,8R,8aR)-3-tert-butyl-5-methyl-8-propan-2-yl-3,4,4a,7,8,8a-hexahydroisochromen-1-one.
| Compound Name | (3R,4aR,8R,8aR)-3-tert-butyl-5-methyl-8-propan-2-yl-3,4,4a,7,8,8a-hexahydroisochromen-1-one |
|---|---|
| PubChem CID | 102007696 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (3R,4aR,8R,8aR)-3-tert-butyl-5-methyl-8-propan-2-yl-3,4,4a,7,8,8a-hexahydroisochromen-1-one |
| SMILES | CC1=CC[C@H](C(C)C)[C@H]2C(=O)O[C@@H](C(C)(C)C)C[C@@H]12 |
| InChI | InChI=1S/C17H28O2/c1-10(2)12-8-7-11(3)13-9-14(17(4,5)6)19-16(18)15(12)13/h7,10,12-15H,8-9H2,1-6H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | COTNHOSUXRVKOP-LXTVHRRPSA-N |
| XLogP | 4.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|