C15H27N — CID 102007823
5-ethyl-N,N-bis(prop-2-enyl)hept-1-en-4-amine (PubChem CID 102007823) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 5-ethyl-N,N-bis(prop-2-enyl)hept-1-en-4-amine.
| Compound Name | 5-ethyl-N,N-bis(prop-2-enyl)hept-1-en-4-amine |
|---|---|
| PubChem CID | 102007823 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 5-ethyl-N,N-bis(prop-2-enyl)hept-1-en-4-amine |
| SMILES | C=CCC(C(CC)CC)N(CC=C)CC=C |
| InChI | InChI=1S/C15H27N/c1-6-11-15(14(9-4)10-5)16(12-7-2)13-8-3/h6-8,14-15H,1-3,9-13H2,4-5H3 |
| InChIKey | NPPBCKYPJHMPSK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|