C17H23N3O6S — CID 10200823
[(2S)-2-[[(4R)-5-(4-methoxyphenyl)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]-4-methylpentyl] nitrate (PubChem CID 10200823) has the molecular formula C17H23N3O6S and a molecular weight of 397.45 g/mol. Its IUPAC name is [(2S)-2-[[(4R)-5-(4-methoxyphenyl)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]-4-methylpentyl] nitrate.
| Compound Name | [(2S)-2-[[(4R)-5-(4-methoxyphenyl)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]-4-methylpentyl] nitrate |
|---|---|
| PubChem CID | 10200823 |
| Molecular Formula | C17H23N3O6S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | [(2S)-2-[[(4R)-5-(4-methoxyphenyl)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]-4-methylpentyl] nitrate |
| SMILES | COc1ccc(C2SC(=O)N[C@@H]2C(=O)N[C@H](CO[N+](=O)[O-])CC(C)C)cc1 |
| InChI | InChI=1S/C17H23N3O6S/c1-10(2)8-12(9-26-20(23)24)18-16(21)14-15(27-17(22)19-14)11-4-6-13(25-3)7-5-11/h4-7,10,12,14-15H,8-9H2,1-3H3,(H,18,21)(H,19,22)/t12-,14-,15?/m0/s1 |
| InChIKey | DHUSXSGUCOCXMF-XRJCJLGXSA-N |
| XLogP | 2.30 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|