C25H32O2Si — CID 102008297
tert-butyl-[[(1S,2R,4S,5R)-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-yl]oxy]-diphenylsilane (PubChem CID 102008297) has the molecular formula C25H32O2Si and a molecular weight of 392.62 g/mol. Its IUPAC name is tert-butyl-[[(1S,2R,4S,5R)-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-yl]oxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1S,2R,4S,5R)-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-yl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 102008297 |
| Molecular Formula | C25H32O2Si |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | tert-butyl-[[(1S,2R,4S,5R)-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-yl]oxy]-diphenylsilane |
| SMILES | C[C@@H]1C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C25H32O2Si/c1-18-22-16-17-23(26-22)19(2)24(18)27-28(25(3,4)5,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-19,22-24H,1-5H3/t18-,19+,22+,23-,24? |
| InChIKey | QXZAGSRGKBJWKY-PNGPYDMHSA-N |
| XLogP | 4.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|