About 3-[(6-aminoquinolin-4-yl)amino]propyl N-(5-cyclobutyl-1,3-thiazol-2-yl)carbamate
3-[(6-aminoquinolin-4-yl)amino]propyl N-(5-cyclobutyl-1,3-thiazol-2-yl)carbamate (PubChem CID 10200834) has the molecular formula C20H23N5O2S
and a molecular weight of 397.50 g/mol. Its IUPAC name is 3-[(6-aminoquinolin-4-yl)amino]propyl N-(5-cyclobutyl-1,3-thiazol-2-yl)carbamate.
Molecular Properties
| Compound Name | 3-[(6-aminoquinolin-4-yl)amino]propyl N-(5-cyclobutyl-1,3-thiazol-2-yl)carbamate |
| PubChem CID | 10200834 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 3-[(6-aminoquinolin-4-yl)amino]propyl N-(5-cyclobutyl-1,3-thiazol-2-yl)carbamate |
| SMILES | Nc1ccc2nccc(NCCCOC(=O)Nc3ncc(C4CCC4)s3)c2c1 |
| InChI | InChI=1S/C20H23N5O2S/c21-14-5-6-16-15(11-14)17(7-9-23-16)22-8-2-10-27-20(26)25-19-24-12-18(28-19)13-3-1-4-13/h5-7,9,11-13H,1-4,8,10,21H2,(H,22,23)(H,24,25,26) |
| InChIKey | VDDFVVQTSGGIQK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(6-aminoquinolin-4-yl)amino]propyl N-(5-cyclobutyl-1,3-thiazol-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-aminoquinolin-4-yl)amino]propyl N-(5-cyclobutyl-1,3-thiazol-2-yl)carbamate?
The IUPAC name of 3-[(6-aminoquinolin-4-yl)amino]propyl N-(5-cyclobutyl-1,3-thiazol-2-yl)carbamate (CID 10200834) is 3-[(6-aminoquinolin-4-yl)amino]propyl N-(5-cyclobutyl-1,3-thiazol-2-yl)carbamate.
What is the SMILES notation for 3-[(6-aminoquinolin-4-yl)amino]propyl N-(5-cyclobutyl-1,3-thiazol-2-yl)carbamate?
The canonical SMILES for 3-[(6-aminoquinolin-4-yl)amino]propyl N-(5-cyclobutyl-1,3-thiazol-2-yl)carbamate is Nc1ccc2nccc(NCCCOC(=O)Nc3ncc(C4CCC4)s3)c2c1.
What is the InChIKey of 3-[(6-aminoquinolin-4-yl)amino]propyl N-(5-cyclobutyl-1,3-thiazol-2-yl)carbamate?
The InChIKey is VDDFVVQTSGGIQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N5O2S/c21-14-5-6-16-15(11-14)17(7-9-23-16)22-8-2-10-27-20(26)25-19-24-12-18(28-19)13-3-1-4-13/h5-7,9,11-13H,1-4,8,10,21H2,(H,22,23)(H,24,25,26).
What are the key properties of 3-[(6-aminoquinolin-4-yl)amino]propyl N-(5-cyclobutyl-1,3-thiazol-2-yl)carbamate?
3-[(6-aminoquinolin-4-yl)amino]propyl N-(5-cyclobutyl-1,3-thiazol-2-yl)carbamate has a molecular weight of 397.50 g/mol, XLogP of 4.59, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-aminoquinolin-4-yl)amino]propyl N-(5-cyclobutyl-1,3-thiazol-2-yl)carbamate is sourced from PubChem (CID 10200834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).