C22H26O7 — CID 102008604
[(3aR,4R,6E,10Z,11aR)-10-(acetyloxymethyl)-6-formyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (Z)-2-methylbut-2-enoate (PubChem CID 102008604) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is [(3aR,4R,6E,10Z,11aR)-10-(acetyloxymethyl)-6-formyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(3aR,4R,6E,10Z,11aR)-10-(acetyloxymethyl)-6-formyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 102008604 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [(3aR,4R,6E,10Z,11aR)-10-(acetyloxymethyl)-6-formyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\COC(C)=O)CC/C=C(/C=O)C[C@@H](OC(=O)/C(C)=C\C)[C@@H]12 |
| InChI | InChI=1S/C22H26O7/c1-5-13(2)21(25)28-18-9-16(11-23)7-6-8-17(12-27-15(4)24)10-19-20(18)14(3)22(26)29-19/h5,7,10-11,18-20H,3,6,8-9,12H2,1-2,4H3/b13-5-,16-7+,17-10-/t18-,19-,20-/m1/s1 |
| InChIKey | UVXIJAUHZZHZLZ-BPWIUAIYSA-N |
| XLogP | 2.76 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|