C8H10F3NOS2 — CID 102009177
2,2,2-trifluoro-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanone (PubChem CID 102009177) has the molecular formula C8H10F3NOS2 and a molecular weight of 257.30 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 102009177 |
| Molecular Formula | C8H10F3NOS2 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 2,2,2-trifluoro-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanone |
| SMILES | CC(C)[C@H]1CSC(=S)N1C(=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NOS2/c1-4(2)5-3-15-7(14)12(5)6(13)8(9,10)11/h4-5H,3H2,1-2H3/t5-/m1/s1 |
| InChIKey | VIIZBSBWKBJDET-RXMQYKEDSA-N |
| XLogP | 2.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|