C18H23F6NO2 — CID 10200929
4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N,N-bis(2-methylpropyl)benzamide (PubChem CID 10200929) has the molecular formula C18H23F6NO2 and a molecular weight of 399.38 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N,N-bis(2-methylpropyl)benzamide.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N,N-bis(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 10200929 |
| Molecular Formula | C18H23F6NO2 |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N,N-bis(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H23F6NO2/c1-11(2)9-25(10-12(3)4)15(26)13-5-7-14(8-6-13)16(27,17(19,20)21)18(22,23)24/h5-8,11-12,27H,9-10H2,1-4H3 |
| InChIKey | QFZFGUSKKOKRRM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |