C28H58OSi5 — CID 102009318
[1-(1-adamantyl)-3-[bis(trimethylsilyl)-trimethylsilyloxysilyl]propa-1,2-dienyl]-tert-butyl-dimethylsilane (PubChem CID 102009318) has the molecular formula C28H58OSi5 and a molecular weight of 551.20 g/mol. Its IUPAC name is [1-(1-adamantyl)-3-[bis(trimethylsilyl)-trimethylsilyloxysilyl]propa-1,2-dienyl]-tert-butyl-dimethylsilane.
| Compound Name | [1-(1-adamantyl)-3-[bis(trimethylsilyl)-trimethylsilyloxysilyl]propa-1,2-dienyl]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102009318 |
| Molecular Formula | C28H58OSi5 |
| Molecular Weight | 551.20 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | [1-(1-adamantyl)-3-[bis(trimethylsilyl)-trimethylsilyloxysilyl]propa-1,2-dienyl]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)C(=C=C[Si](O[Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H58OSi5/c1-27(2,3)33(13,14)26(28-20-23-17-24(21-28)19-25(18-23)22-28)15-16-34(31(7,8)9,32(10,11)12)29-30(4,5)6/h16,23-25H,17-22H2,1-14H3 |
| InChIKey | VDWJAORRDSRNIY-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.20 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|