About [(2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)propyl] trifluoromethanesulfonate
[(2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)propyl] trifluoromethanesulfonate (PubChem CID 102009371) has the molecular formula C20H14F3NO5S
and a molecular weight of 437.40 g/mol. Its IUPAC name is [(2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)propyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)propyl] trifluoromethanesulfonate |
| PubChem CID | 102009371 |
| Molecular Formula | C20H14F3NO5S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | [(2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)propyl] trifluoromethanesulfonate |
| SMILES | C[C@H](COS(=O)(=O)C(F)(F)F)N1C(=O)c2cc3cc4ccccc4cc3cc2C1=O |
| InChI | InChI=1S/C20H14F3NO5S/c1-11(10-29-30(27,28)20(21,22)23)24-18(25)16-8-14-6-12-4-2-3-5-13(12)7-15(14)9-17(16)19(24)26/h2-9,11H,10H2,1H3/t11-/m1/s1 |
| InChIKey | DIICGNQPGBFRDZ-LLVKDONJSA-N |
| XLogP | 3.84 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)propyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)propyl] trifluoromethanesulfonate?
The IUPAC name of [(2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)propyl] trifluoromethanesulfonate (CID 102009371) is [(2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)propyl] trifluoromethanesulfonate.
What is the SMILES notation for [(2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)propyl] trifluoromethanesulfonate?
The canonical SMILES for [(2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)propyl] trifluoromethanesulfonate is C[C@H](COS(=O)(=O)C(F)(F)F)N1C(=O)c2cc3cc4ccccc4cc3cc2C1=O.
What is the InChIKey of [(2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)propyl] trifluoromethanesulfonate?
The InChIKey is DIICGNQPGBFRDZ-LLVKDONJSA-N. The full InChI is InChI=1S/C20H14F3NO5S/c1-11(10-29-30(27,28)20(21,22)23)24-18(25)16-8-14-6-12-4-2-3-5-13(12)7-15(14)9-17(16)19(24)26/h2-9,11H,10H2,1H3/t11-/m1/s1.
What are the key properties of [(2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)propyl] trifluoromethanesulfonate?
[(2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)propyl] trifluoromethanesulfonate has a molecular weight of 437.40 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)propyl] trifluoromethanesulfonate is sourced from PubChem (CID 102009371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).