About 2-methylpropyl 2-diazobutanoate
2-methylpropyl 2-diazobutanoate (PubChem CID 102009439) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-methylpropyl 2-diazobutanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-diazobutanoate |
| PubChem CID | 102009439 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-methylpropyl 2-diazobutanoate |
| SMILES | CCC(=[N+]=[N-])C(=O)OCC(C)C |
| InChI | InChI=1S/C8H14N2O2/c1-4-7(10-9)8(11)12-5-6(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | UXMPWVOBQJMLHS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 2-diazobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-diazobutanoate?
The IUPAC name of 2-methylpropyl 2-diazobutanoate (CID 102009439) is 2-methylpropyl 2-diazobutanoate.
What is the SMILES notation for 2-methylpropyl 2-diazobutanoate?
The canonical SMILES for 2-methylpropyl 2-diazobutanoate is CCC(=[N+]=[N-])C(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl 2-diazobutanoate?
The InChIKey is UXMPWVOBQJMLHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-4-7(10-9)8(11)12-5-6(2)3/h6H,4-5H2,1-3H3.
What are the key properties of 2-methylpropyl 2-diazobutanoate?
2-methylpropyl 2-diazobutanoate has a molecular weight of 170.21 g/mol, XLogP of 1.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-diazobutanoate is sourced from PubChem (CID 102009439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).