C25H21NO2S — CID 10200949
2-(3-ethyl-5-methyl-1,3-benzothiazol-2-ylidene)-1,3-diphenylpropane-1,3-dione (PubChem CID 10200949) has the molecular formula C25H21NO2S and a molecular weight of 399.52 g/mol. Its IUPAC name is 2-(3-ethyl-5-methyl-1,3-benzothiazol-2-ylidene)-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-(3-ethyl-5-methyl-1,3-benzothiazol-2-ylidene)-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 10200949 |
| Molecular Formula | C25H21NO2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-(3-ethyl-5-methyl-1,3-benzothiazol-2-ylidene)-1,3-diphenylpropane-1,3-dione |
| SMILES | CCN1C(=C(C(=O)c2ccccc2)C(=O)c2ccccc2)Sc2ccc(C)cc21 |
| InChI | InChI=1S/C25H21NO2S/c1-3-26-20-16-17(2)14-15-21(20)29-25(26)22(23(27)18-10-6-4-7-11-18)24(28)19-12-8-5-9-13-19/h4-16H,3H2,1-2H3 |
| InChIKey | ARHRHEUVLOMLCB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|