About phenyl-(3,4,5-trichlorothiophen-2-yl)methanol
phenyl-(3,4,5-trichlorothiophen-2-yl)methanol (PubChem CID 102009538) has the molecular formula C11H7Cl3OS
and a molecular weight of 293.60 g/mol. Its IUPAC name is phenyl-(3,4,5-trichlorothiophen-2-yl)methanol.
Molecular Properties
| Compound Name | phenyl-(3,4,5-trichlorothiophen-2-yl)methanol |
| PubChem CID | 102009538 |
| Molecular Formula | C11H7Cl3OS |
| Molecular Weight | 293.60 g/mol |
| Exact Mass | 291.93 |
| IUPAC Name | phenyl-(3,4,5-trichlorothiophen-2-yl)methanol |
| SMILES | OC(c1ccccc1)c1sc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H7Cl3OS/c12-7-8(13)11(14)16-10(7)9(15)6-4-2-1-3-5-6/h1-5,9,15H |
| InChIKey | BULWUTJMYURWIC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenyl-(3,4,5-trichlorothiophen-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(3,4,5-trichlorothiophen-2-yl)methanol?
The IUPAC name of phenyl-(3,4,5-trichlorothiophen-2-yl)methanol (CID 102009538) is phenyl-(3,4,5-trichlorothiophen-2-yl)methanol.
What is the SMILES notation for phenyl-(3,4,5-trichlorothiophen-2-yl)methanol?
The canonical SMILES for phenyl-(3,4,5-trichlorothiophen-2-yl)methanol is OC(c1ccccc1)c1sc(Cl)c(Cl)c1Cl.
What is the InChIKey of phenyl-(3,4,5-trichlorothiophen-2-yl)methanol?
The InChIKey is BULWUTJMYURWIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Cl3OS/c12-7-8(13)11(14)16-10(7)9(15)6-4-2-1-3-5-6/h1-5,9,15H.
What are the key properties of phenyl-(3,4,5-trichlorothiophen-2-yl)methanol?
phenyl-(3,4,5-trichlorothiophen-2-yl)methanol has a molecular weight of 293.60 g/mol, XLogP of 4.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(3,4,5-trichlorothiophen-2-yl)methanol is sourced from PubChem (CID 102009538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).