C24H34O8 — CID 102010172
[(1R,2S,3R,10Z,14R,15S)-2-acetyloxy-8-hydroxy-1,5,10,14-tetramethyl-6-oxo-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-3-yl] acetate (PubChem CID 102010172) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is [(1R,2S,3R,10Z,14R,15S)-2-acetyloxy-8-hydroxy-1,5,10,14-tetramethyl-6-oxo-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-3-yl] acetate.
| Compound Name | [(1R,2S,3R,10Z,14R,15S)-2-acetyloxy-8-hydroxy-1,5,10,14-tetramethyl-6-oxo-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-3-yl] acetate |
|---|---|
| PubChem CID | 102010172 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(1R,2S,3R,10Z,14R,15S)-2-acetyloxy-8-hydroxy-1,5,10,14-tetramethyl-6-oxo-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C2=C(C)C(=O)OC2(O)C/C(C)=C\CC[C@@H](C)[C@@H]2CC[C@@](C)(O2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H34O8/c1-13-8-7-9-14(2)18-10-11-23(6,31-18)21(30-17(5)26)20(29-16(4)25)19-15(3)22(27)32-24(19,28)12-13/h8,14,18,20-21,28H,7,9-12H2,1-6H3/b13-8-/t14-,18+,20-,21+,23-,24?/m1/s1 |
| InChIKey | MYOSOCZXLZVXDH-DGUOTYFFSA-N |
| XLogP | 3.12 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|