About 5-methyl-2-[(E)-2-phenylethenyl]-5-prop-1-en-2-yl-1,3-oxathiolane
5-methyl-2-[(E)-2-phenylethenyl]-5-prop-1-en-2-yl-1,3-oxathiolane (PubChem CID 102010317) has the molecular formula C15H18OS
and a molecular weight of 246.38 g/mol. Its IUPAC name is 5-methyl-2-[(E)-2-phenylethenyl]-5-prop-1-en-2-yl-1,3-oxathiolane.
Molecular Properties
| Compound Name | 5-methyl-2-[(E)-2-phenylethenyl]-5-prop-1-en-2-yl-1,3-oxathiolane |
| PubChem CID | 102010317 |
| Molecular Formula | C15H18OS |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 5-methyl-2-[(E)-2-phenylethenyl]-5-prop-1-en-2-yl-1,3-oxathiolane |
| SMILES | C=C(C)C1(C)CSC(/C=C/c2ccccc2)O1 |
| InChI | InChI=1S/C15H18OS/c1-12(2)15(3)11-17-14(16-15)10-9-13-7-5-4-6-8-13/h4-10,14H,1,11H2,2-3H3/b10-9+ |
| InChIKey | VVJZOICIZUIEOP-MDZDMXLPSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-[(E)-2-phenylethenyl]-5-prop-1-en-2-yl-1,3-oxathiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-[(E)-2-phenylethenyl]-5-prop-1-en-2-yl-1,3-oxathiolane?
The IUPAC name of 5-methyl-2-[(E)-2-phenylethenyl]-5-prop-1-en-2-yl-1,3-oxathiolane (CID 102010317) is 5-methyl-2-[(E)-2-phenylethenyl]-5-prop-1-en-2-yl-1,3-oxathiolane.
What is the SMILES notation for 5-methyl-2-[(E)-2-phenylethenyl]-5-prop-1-en-2-yl-1,3-oxathiolane?
The canonical SMILES for 5-methyl-2-[(E)-2-phenylethenyl]-5-prop-1-en-2-yl-1,3-oxathiolane is C=C(C)C1(C)CSC(/C=C/c2ccccc2)O1.
What is the InChIKey of 5-methyl-2-[(E)-2-phenylethenyl]-5-prop-1-en-2-yl-1,3-oxathiolane?
The InChIKey is VVJZOICIZUIEOP-MDZDMXLPSA-N. The full InChI is InChI=1S/C15H18OS/c1-12(2)15(3)11-17-14(16-15)10-9-13-7-5-4-6-8-13/h4-10,14H,1,11H2,2-3H3/b10-9+.
What are the key properties of 5-methyl-2-[(E)-2-phenylethenyl]-5-prop-1-en-2-yl-1,3-oxathiolane?
5-methyl-2-[(E)-2-phenylethenyl]-5-prop-1-en-2-yl-1,3-oxathiolane has a molecular weight of 246.38 g/mol, XLogP of 4.12, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-[(E)-2-phenylethenyl]-5-prop-1-en-2-yl-1,3-oxathiolane is sourced from PubChem (CID 102010317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).