C8H8Br2O2 — CID 102010603
(1R,2R,3S,4S,5S,6S)-3,4-dibromo-7,8-dioxatricyclo[4.2.2.02,5]dec-9-ene (PubChem CID 102010603) has the molecular formula C8H8Br2O2 and a molecular weight of 295.96 g/mol. Its IUPAC name is (1R,2R,3S,4S,5S,6S)-3,4-dibromo-7,8-dioxatricyclo[4.2.2.02,5]dec-9-ene.
| Compound Name | (1R,2R,3S,4S,5S,6S)-3,4-dibromo-7,8-dioxatricyclo[4.2.2.02,5]dec-9-ene |
|---|---|
| PubChem CID | 102010603 |
| Molecular Formula | C8H8Br2O2 |
| Molecular Weight | 295.96 g/mol |
| Exact Mass | 293.89 |
| IUPAC Name | (1R,2R,3S,4S,5S,6S)-3,4-dibromo-7,8-dioxatricyclo[4.2.2.02,5]dec-9-ene |
| SMILES | Br[C@@H]1[C@@H](Br)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2OO1 |
| InChI | InChI=1S/C8H8Br2O2/c9-7-5-3-1-2-4(12-11-3)6(5)8(7)10/h1-8H/t3-,4+,5+,6-,7-,8-/m0/s1 |
| InChIKey | BMZGQZJEABVSKN-WQJFPXAQSA-N |
| XLogP | 2.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.96 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|