About 4-(4-benzyl-4-hydroxypiperidin-1-yl)-9H-pyrimido[4,5-b]indole-6-carboxamide
4-(4-benzyl-4-hydroxypiperidin-1-yl)-9H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 10201064) has the molecular formula C23H23N5O2
and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-(4-benzyl-4-hydroxypiperidin-1-yl)-9H-pyrimido[4,5-b]indole-6-carboxamide.
Molecular Properties
| Compound Name | 4-(4-benzyl-4-hydroxypiperidin-1-yl)-9H-pyrimido[4,5-b]indole-6-carboxamide |
| PubChem CID | 10201064 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 4-(4-benzyl-4-hydroxypiperidin-1-yl)-9H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | NC(=O)c1ccc2[nH]c3ncnc(N4CCC(O)(Cc5ccccc5)CC4)c3c2c1 |
| InChI | InChI=1S/C23H23N5O2/c24-20(29)16-6-7-18-17(12-16)19-21(27-18)25-14-26-22(19)28-10-8-23(30,9-11-28)13-15-4-2-1-3-5-15/h1-7,12,14,30H,8-11,13H2,(H2,24,29)(H,25,26,27) |
| InChIKey | RFDUKOVARZLCML-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-benzyl-4-hydroxypiperidin-1-yl)-9H-pyrimido[4,5-b]indole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-benzyl-4-hydroxypiperidin-1-yl)-9H-pyrimido[4,5-b]indole-6-carboxamide?
The IUPAC name of 4-(4-benzyl-4-hydroxypiperidin-1-yl)-9H-pyrimido[4,5-b]indole-6-carboxamide (CID 10201064) is 4-(4-benzyl-4-hydroxypiperidin-1-yl)-9H-pyrimido[4,5-b]indole-6-carboxamide.
What is the SMILES notation for 4-(4-benzyl-4-hydroxypiperidin-1-yl)-9H-pyrimido[4,5-b]indole-6-carboxamide?
The canonical SMILES for 4-(4-benzyl-4-hydroxypiperidin-1-yl)-9H-pyrimido[4,5-b]indole-6-carboxamide is NC(=O)c1ccc2[nH]c3ncnc(N4CCC(O)(Cc5ccccc5)CC4)c3c2c1.
What is the InChIKey of 4-(4-benzyl-4-hydroxypiperidin-1-yl)-9H-pyrimido[4,5-b]indole-6-carboxamide?
The InChIKey is RFDUKOVARZLCML-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N5O2/c24-20(29)16-6-7-18-17(12-16)19-21(27-18)25-14-26-22(19)28-10-8-23(30,9-11-28)13-15-4-2-1-3-5-15/h1-7,12,14,30H,8-11,13H2,(H2,24,29)(H,25,26,27).
What are the key properties of 4-(4-benzyl-4-hydroxypiperidin-1-yl)-9H-pyrimido[4,5-b]indole-6-carboxamide?
4-(4-benzyl-4-hydroxypiperidin-1-yl)-9H-pyrimido[4,5-b]indole-6-carboxamide has a molecular weight of 401.47 g/mol, XLogP of 2.78, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-benzyl-4-hydroxypiperidin-1-yl)-9H-pyrimido[4,5-b]indole-6-carboxamide is sourced from PubChem (CID 10201064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).